C10H13Br — CID 123520073
1-(bromomethyl)-6,7-dimethylcyclohepta-1,3,5-triene (PubChem CID 123520073) has the molecular formula C10H13Br and a molecular weight of 213.12 g/mol. Its IUPAC name is 1-(bromomethyl)-6,7-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 1-(bromomethyl)-6,7-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123520073 |
| Molecular Formula | C10H13Br |
| Molecular Weight | 213.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1-(bromomethyl)-6,7-dimethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC=CC=C(CBr)C1C |
| InChI | InChI=1S/C10H13Br/c1-8-5-3-4-6-10(7-11)9(8)2/h3-6,9H,7H2,1-2H3 |
| InChIKey | LMXCDTZYTUWTMY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|