About 5-nitro-2-propan-2-yl-2,3-dihydropyridine
5-nitro-2-propan-2-yl-2,3-dihydropyridine (PubChem CID 123520274) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-nitro-2-propan-2-yl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 5-nitro-2-propan-2-yl-2,3-dihydropyridine |
| PubChem CID | 123520274 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-nitro-2-propan-2-yl-2,3-dihydropyridine |
| SMILES | CC(C)C1CC=C([N+](=O)[O-])C=N1 |
| InChI | InChI=1S/C8H12N2O2/c1-6(2)8-4-3-7(5-9-8)10(11)12/h3,5-6,8H,4H2,1-2H3 |
| InChIKey | OAIQPSOPJFOGSU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2-propan-2-yl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2-propan-2-yl-2,3-dihydropyridine?
The IUPAC name of 5-nitro-2-propan-2-yl-2,3-dihydropyridine (CID 123520274) is 5-nitro-2-propan-2-yl-2,3-dihydropyridine.
What is the SMILES notation for 5-nitro-2-propan-2-yl-2,3-dihydropyridine?
The canonical SMILES for 5-nitro-2-propan-2-yl-2,3-dihydropyridine is CC(C)C1CC=C([N+](=O)[O-])C=N1.
What is the InChIKey of 5-nitro-2-propan-2-yl-2,3-dihydropyridine?
The InChIKey is OAIQPSOPJFOGSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-6(2)8-4-3-7(5-9-8)10(11)12/h3,5-6,8H,4H2,1-2H3.
What are the key properties of 5-nitro-2-propan-2-yl-2,3-dihydropyridine?
5-nitro-2-propan-2-yl-2,3-dihydropyridine has a molecular weight of 168.20 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2-propan-2-yl-2,3-dihydropyridine is sourced from PubChem (CID 123520274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).