C53H60F4N18O3 — CID 123520442
bis[2-[4-[6-[2-(difluoromethyl)-1H-benzimidazol-4-yl]-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]pyrrolidin-1-yl]methanone (PubChem CID 123520442) has the molecular formula C53H60F4N18O3 and a molecular weight of 1073.18 g/mol. Its IUPAC name is bis[2-[4-[6-[2-(difluoromethyl)-1H-benzimidazol-4-yl]-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]pyrrolidin-1-yl]methanone.
| Compound Name | bis[2-[4-[6-[2-(difluoromethyl)-1H-benzimidazol-4-yl]-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 123520442 |
| Molecular Formula | C53H60F4N18O3 |
| Molecular Weight | 1073.18 g/mol |
| Exact Mass | 1072.50 |
| IUPAC Name | bis[2-[4-[6-[2-(difluoromethyl)-1H-benzimidazol-4-yl]-2-morpholin-4-ylpurin-9-yl]piperidin-1-yl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCCC1N1CCC(n2cnc3c(-c4cccc5[nH]c(C(F)F)nc45)nc(N4CCOCC4)nc32)CC1)N1CCCC1N1CCC(n2cnc3c(-c4cccc5[nH]c(C(F)F)nc45)nc(N4CCOCC4)nc32)CC1 |
| InChI | InChI=1S/C53H60F4N18O3/c54-45(55)47-60-35-7-1-5-33(39(35)62-47)41-43-49(66-51(64-41)70-21-25-77-26-22-70)74(29-58-43)31-11-17-68(18-12-31)37-9-3-15-72(37)53(76)73-16-4-10-38(73)69-19-13-32(14-20-69)75-30-59-44-42(65-52(67-50(44)75)71-23-27-78-28-24-71)34-6-2-8-36-40(34)63-48(61-36)46(56)57/h1-2,5-8,29-32,37-38,45-46H,3-4,9-28H2,(H,60,62)(H,61,63) |
| InChIKey | AMLFDPJJGJMYFS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 199.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.18 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |