About 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide
3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide (PubChem CID 123521031) has the molecular formula C12H21F2NO
and a molecular weight of 233.30 g/mol. Its IUPAC name is 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide.
Molecular Properties
| Compound Name | 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide |
| PubChem CID | 123521031 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide |
| SMILES | C=CC(F)(F)C(CCCCC)CC(=O)NC |
| InChI | InChI=1S/C12H21F2NO/c1-4-6-7-8-10(9-11(16)15-3)12(13,14)5-2/h5,10H,2,4,6-9H2,1,3H3,(H,15,16) |
| InChIKey | ZXBMSRVOQWPAOU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide?
The IUPAC name of 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide (CID 123521031) is 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide.
What is the SMILES notation for 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide?
The canonical SMILES for 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide is C=CC(F)(F)C(CCCCC)CC(=O)NC.
What is the InChIKey of 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide?
The InChIKey is ZXBMSRVOQWPAOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO/c1-4-6-7-8-10(9-11(16)15-3)12(13,14)5-2/h5,10H,2,4,6-9H2,1,3H3,(H,15,16).
What are the key properties of 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide?
3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide has a molecular weight of 233.30 g/mol, XLogP of 3.14, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoroprop-2-enyl)-N-methyloctanamide is sourced from PubChem (CID 123521031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).