C16H17F2NO — CID 123521519
3-(2,5-difluorophenyl)-1-hexa-2,4-dien-3-ylpyrrolidin-2-one (PubChem CID 123521519) has the molecular formula C16H17F2NO and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-1-hexa-2,4-dien-3-ylpyrrolidin-2-one.
| Compound Name | 3-(2,5-difluorophenyl)-1-hexa-2,4-dien-3-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 123521519 |
| Molecular Formula | C16H17F2NO |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-(2,5-difluorophenyl)-1-hexa-2,4-dien-3-ylpyrrolidin-2-one |
| SMILES | CC=CC(=CC)N1CCC(c2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C16H17F2NO/c1-3-5-12(4-2)19-9-8-13(16(19)20)14-10-11(17)6-7-15(14)18/h3-7,10,13H,8-9H2,1-2H3 |
| InChIKey | RWKWOTLSRCXKBL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|