C17H28O — CID 123521676
3,3-dimethyl-9-propyltricyclo[7.2.1.02,7]dodecan-8-one (PubChem CID 123521676) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 3,3-dimethyl-9-propyltricyclo[7.2.1.02,7]dodecan-8-one.
| Compound Name | 3,3-dimethyl-9-propyltricyclo[7.2.1.02,7]dodecan-8-one |
|---|---|
| PubChem CID | 123521676 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 3,3-dimethyl-9-propyltricyclo[7.2.1.02,7]dodecan-8-one |
| SMILES | CCCC12CCC(C1)C1C(CCCC1(C)C)C2=O |
| InChI | InChI=1S/C17H28O/c1-4-8-17-10-7-12(11-17)14-13(15(17)18)6-5-9-16(14,2)3/h12-14H,4-11H2,1-3H3 |
| InChIKey | NUNGRIXTBCXAJO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |