C25H38O4S — CID 123521814
(3-cyclohexa-1,5-dien-1-yl-3-hydroxypropyl) 2,4,6-tri(propan-2-yl)cyclohepta-1,3,5-triene-1-sulfonate (PubChem CID 123521814) has the molecular formula C25H38O4S and a molecular weight of 434.64 g/mol. Its IUPAC name is (3-cyclohexa-1,5-dien-1-yl-3-hydroxypropyl) 2,4,6-tri(propan-2-yl)cyclohepta-1,3,5-triene-1-sulfonate.
| Compound Name | (3-cyclohexa-1,5-dien-1-yl-3-hydroxypropyl) 2,4,6-tri(propan-2-yl)cyclohepta-1,3,5-triene-1-sulfonate |
|---|---|
| PubChem CID | 123521814 |
| Molecular Formula | C25H38O4S |
| Molecular Weight | 434.64 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (3-cyclohexa-1,5-dien-1-yl-3-hydroxypropyl) 2,4,6-tri(propan-2-yl)cyclohepta-1,3,5-triene-1-sulfonate |
| SMILES | CC(C)C1=CC(C(C)C)=C(S(=O)(=O)OCCC(O)C2=CCCC=C2)CC(C(C)C)=C1 |
| InChI | InChI=1S/C25H38O4S/c1-17(2)21-14-22(18(3)4)16-25(23(15-21)19(5)6)30(27,28)29-13-12-24(26)20-10-8-7-9-11-20/h8,10-11,14-15,17-19,24,26H,7,9,12-13,16H2,1-6H3 |
| InChIKey | LPUXTWKJTPABMI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|