C14H19F2N — CID 123522068
1-(3,5-difluorophenyl)-N-prop-2-enylpentan-1-amine (PubChem CID 123522068) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-N-prop-2-enylpentan-1-amine.
| Compound Name | 1-(3,5-difluorophenyl)-N-prop-2-enylpentan-1-amine |
|---|---|
| PubChem CID | 123522068 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-(3,5-difluorophenyl)-N-prop-2-enylpentan-1-amine |
| SMILES | C=CCNC(CCCC)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H19F2N/c1-3-5-6-14(17-7-4-2)11-8-12(15)10-13(16)9-11/h4,8-10,14,17H,2-3,5-7H2,1H3 |
| InChIKey | UNNSDXHBIJWDQX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|