C21H32ClNO4 — CID 123522247
4-(2-chloroethyl)-1-[(5-hexylcyclohex-2-en-1-yl)-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 123522247) has the molecular formula C21H32ClNO4 and a molecular weight of 397.94 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1-[(5-hexylcyclohex-2-en-1-yl)-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | 4-(2-chloroethyl)-1-[(5-hexylcyclohex-2-en-1-yl)-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 123522247 |
| Molecular Formula | C21H32ClNO4 |
| Molecular Weight | 397.94 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-(2-chloroethyl)-1-[(5-hexylcyclohex-2-en-1-yl)-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CCCCCCC1CC=CC(C(O)C23NC(=O)C(CCCl)C2(C)OC3=O)C1 |
| InChI | InChI=1S/C21H32ClNO4/c1-3-4-5-6-8-14-9-7-10-15(13-14)17(24)21-19(26)27-20(21,2)16(11-12-22)18(25)23-21/h7,10,14-17,24H,3-6,8-9,11-13H2,1-2H3,(H,23,25) |
| InChIKey | KKITUMLLFZIPCU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.94 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|