C23H26F3N3O4 — CID 123522340
2-oxopropyl 4-[4-[6-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate (PubChem CID 123522340) has the molecular formula C23H26F3N3O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is 2-oxopropyl 4-[4-[6-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate.
| Compound Name | 2-oxopropyl 4-[4-[6-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate |
|---|---|
| PubChem CID | 123522340 |
| Molecular Formula | C23H26F3N3O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-oxopropyl 4-[4-[6-[3-(trifluoromethoxy)phenyl]-2-pyridinyl]piperazin-1-yl]butanoate |
| SMILES | CC(=O)COC(=O)CCCN1CCN(c2cccc(-c3cccc(OC(F)(F)F)c3)n2)CC1 |
| InChI | InChI=1S/C23H26F3N3O4/c1-17(30)16-32-22(31)9-4-10-28-11-13-29(14-12-28)21-8-3-7-20(27-21)18-5-2-6-19(15-18)33-23(24,25)26/h2-3,5-8,15H,4,9-14,16H2,1H3 |
| InChIKey | NIWDNBAJZLUAEM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |