About 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate
2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate (PubChem CID 123522341) has the molecular formula C24H31N3O4
and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate.
Molecular Properties
| Compound Name | 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate |
| PubChem CID | 123522341 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate |
| SMILES | CCC(=O)COC(=O)CCCN1CCN(c2cccc(-c3ccc(OC)cc3)n2)CC1 |
| InChI | InChI=1S/C24H31N3O4/c1-3-20(28)18-31-24(29)8-5-13-26-14-16-27(17-15-26)23-7-4-6-22(25-23)19-9-11-21(30-2)12-10-19/h4,6-7,9-12H,3,5,8,13-18H2,1-2H3 |
| InChIKey | HDPIYTPHXLWZKQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate?
The IUPAC name of 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate (CID 123522341) is 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate.
What is the SMILES notation for 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate?
The canonical SMILES for 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate is CCC(=O)COC(=O)CCCN1CCN(c2cccc(-c3ccc(OC)cc3)n2)CC1.
What is the InChIKey of 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate?
The InChIKey is HDPIYTPHXLWZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O4/c1-3-20(28)18-31-24(29)8-5-13-26-14-16-27(17-15-26)23-7-4-6-22(25-23)19-9-11-21(30-2)12-10-19/h4,6-7,9-12H,3,5,8,13-18H2,1-2H3.
What are the key properties of 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate?
2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate has a molecular weight of 425.53 g/mol, XLogP of 3.18, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxobutyl 4-[4-[6-(4-methoxyphenyl)-2-pyridinyl]piperazin-1-yl]butanoate is sourced from PubChem (CID 123522341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).