C28H38N2OS — CID 123522538
1-[3-(1-benzothiophen-3-yl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone (PubChem CID 123522538) has the molecular formula C28H38N2OS and a molecular weight of 450.69 g/mol. Its IUPAC name is 1-[3-(1-benzothiophen-3-yl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone.
| Compound Name | 1-[3-(1-benzothiophen-3-yl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
|---|---|
| PubChem CID | 123522538 |
| Molecular Formula | C28H38N2OS |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 1-[3-(1-benzothiophen-3-yl)-2-pentyl-3,4-dihydropyrazol-5-yl]-2-[(1S,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]ethanone |
| SMILES | CCCCCN1N=C(C(=O)C[C@H]2C[C@H]3CC[C@]2(C)C3(C)C)CC1c1csc2ccccc12 |
| InChI | InChI=1S/C28H38N2OS/c1-5-6-9-14-30-24(22-18-32-26-11-8-7-10-21(22)26)17-23(29-30)25(31)16-20-15-19-12-13-28(20,4)27(19,2)3/h7-8,10-11,18-20,24H,5-6,9,12-17H2,1-4H3/t19-,20-,24?,28+/m1/s1 |
| InChIKey | XBXCXQMDJIVNKJ-CQXNXJMASA-N |
| XLogP | 7.62 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|