C11H19BrO2 — CID 123522891
(3S,4S,5R)-8-bromo-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol (PubChem CID 123522891) has the molecular formula C11H19BrO2 and a molecular weight of 263.18 g/mol. Its IUPAC name is (3S,4S,5R)-8-bromo-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol.
| Compound Name | (3S,4S,5R)-8-bromo-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 123522891 |
| Molecular Formula | C11H19BrO2 |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (3S,4S,5R)-8-bromo-3-methoxy-5,7-dimethylocta-1,6-dien-4-ol |
| SMILES | C=C[C@H](OC)[C@@H](O)[C@H](C)C=C(C)CBr |
| InChI | InChI=1S/C11H19BrO2/c1-5-10(14-4)11(13)9(3)6-8(2)7-12/h5-6,9-11,13H,1,7H2,2-4H3/t9-,10+,11+/m1/s1 |
| InChIKey | YNZWQDLGJYDJJP-VWYCJHECSA-N |
| XLogP | 2.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|