C20H40O2Si — CID 123523016
(2R,3R,4S,4aR,5R,8aS)-3,4a,8,8-tetramethyl-4-[(3R)-3-methylpentyl]-5-silyloxy-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol (PubChem CID 123523016) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is (2R,3R,4S,4aR,5R,8aS)-3,4a,8,8-tetramethyl-4-[(3R)-3-methylpentyl]-5-silyloxy-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol.
| Compound Name | (2R,3R,4S,4aR,5R,8aS)-3,4a,8,8-tetramethyl-4-[(3R)-3-methylpentyl]-5-silyloxy-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 123523016 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (2R,3R,4S,4aR,5R,8aS)-3,4a,8,8-tetramethyl-4-[(3R)-3-methylpentyl]-5-silyloxy-1,2,3,4,5,6,7,8a-octahydronaphthalen-2-ol |
| SMILES | CC[C@@H](C)CC[C@H]1[C@@H](C)[C@H](O)C[C@H]2C(C)(C)CC[C@@H](O[SiH3])[C@]12C |
| InChI | InChI=1S/C20H40O2Si/c1-7-13(2)8-9-15-14(3)16(21)12-17-19(4,5)11-10-18(22-23)20(15,17)6/h13-18,21H,7-12H2,1-6,23H3/t13-,14-,15+,16-,17+,18-,20-/m1/s1 |
| InChIKey | QYFKRZLGLURKGQ-MHASKIKASA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|