About dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate
dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate (PubChem CID 123523064) has the molecular formula C13H22O4Si
and a molecular weight of 270.40 g/mol. Its IUPAC name is dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate.
Molecular Properties
| Compound Name | dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate |
| PubChem CID | 123523064 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate |
| SMILES | C=C(C)C(=O)OCCCCC(=C)C(=O)O[SiH](C)C |
| InChI | InChI=1S/C13H22O4Si/c1-10(2)12(14)16-9-7-6-8-11(3)13(15)17-18(4)5/h18H,1,3,6-9H2,2,4-5H3 |
| InChIKey | CVXRNKONNYHLLE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate?
The IUPAC name of dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate (CID 123523064) is dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate.
What is the SMILES notation for dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate?
The canonical SMILES for dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate is C=C(C)C(=O)OCCCCC(=C)C(=O)O[SiH](C)C.
What is the InChIKey of dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate?
The InChIKey is CVXRNKONNYHLLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4Si/c1-10(2)12(14)16-9-7-6-8-11(3)13(15)17-18(4)5/h18H,1,3,6-9H2,2,4-5H3.
What are the key properties of dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate?
dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate has a molecular weight of 270.40 g/mol, XLogP of 2.36, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilyl 2-methylidene-6-(2-methylprop-2-enoyloxy)hexanoate is sourced from PubChem (CID 123523064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).