C21H22BBrO2 — CID 123523359
2-(10-bromo-2-methylanthracen-9-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123523359) has the molecular formula C21H22BBrO2 and a molecular weight of 397.12 g/mol. Its IUPAC name is 2-(10-bromo-2-methylanthracen-9-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(10-bromo-2-methylanthracen-9-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123523359 |
| Molecular Formula | C21H22BBrO2 |
| Molecular Weight | 397.12 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-(10-bromo-2-methylanthracen-9-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1ccc2c(Br)c3ccccc3c(B3OC(C)(C)C(C)(C)O3)c2c1 |
| InChI | InChI=1S/C21H22BBrO2/c1-13-10-11-16-17(12-13)18(14-8-6-7-9-15(14)19(16)23)22-24-20(2,3)21(4,5)25-22/h6-12H,1-5H3 |
| InChIKey | IXQLTNFMGCIQHQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.12 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|