C25H43N3O — CID 123523545
N-[4-(4-cyclohexylpiperazin-1-yl)butyl]-N-(2,6-dimethylhepta-1,3,5-trien-3-yl)acetamide (PubChem CID 123523545) has the molecular formula C25H43N3O and a molecular weight of 401.64 g/mol. Its IUPAC name is N-[4-(4-cyclohexylpiperazin-1-yl)butyl]-N-(2,6-dimethylhepta-1,3,5-trien-3-yl)acetamide.
| Compound Name | N-[4-(4-cyclohexylpiperazin-1-yl)butyl]-N-(2,6-dimethylhepta-1,3,5-trien-3-yl)acetamide |
|---|---|
| PubChem CID | 123523545 |
| Molecular Formula | C25H43N3O |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.34 |
| IUPAC Name | N-[4-(4-cyclohexylpiperazin-1-yl)butyl]-N-(2,6-dimethylhepta-1,3,5-trien-3-yl)acetamide |
| SMILES | C=C(C)C(=CC=C(C)C)N(CCCCN1CCN(C2CCCCC2)CC1)C(C)=O |
| InChI | InChI=1S/C25H43N3O/c1-21(2)13-14-25(22(3)4)28(23(5)29)16-10-9-15-26-17-19-27(20-18-26)24-11-7-6-8-12-24/h13-14,24H,3,6-12,15-20H2,1-2,4-5H3 |
| InChIKey | MOAIWOONUJHKEM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|