C20H27FN2O7 — CID 123523590
1-(4-amino-4-carboxybutanoyl)-4-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid (PubChem CID 123523590) has the molecular formula C20H27FN2O7 and a molecular weight of 426.44 g/mol. Its IUPAC name is 1-(4-amino-4-carboxybutanoyl)-4-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(4-amino-4-carboxybutanoyl)-4-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 123523590 |
| Molecular Formula | C20H27FN2O7 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-(4-amino-4-carboxybutanoyl)-4-[[4-(2-fluoroethoxymethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid |
| SMILES | NC(CCC(=O)N1CC(OCc2ccc(COCCF)cc2)CC1C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27FN2O7/c21-7-8-29-11-13-1-3-14(4-2-13)12-30-15-9-17(20(27)28)23(10-15)18(24)6-5-16(22)19(25)26/h1-4,15-17H,5-12,22H2,(H,25,26)(H,27,28) |
| InChIKey | LUBNVAZURIMSFS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|