C30H35N7O2Si — CID 123523678
2-[(2S)-1-[5-ethenyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-2-yl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 123523678) has the molecular formula C30H35N7O2Si and a molecular weight of 553.74 g/mol. Its IUPAC name is 2-[(2S)-1-[5-ethenyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-2-yl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[(2S)-1-[5-ethenyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-2-yl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 123523678 |
| Molecular Formula | C30H35N7O2Si |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 2-[(2S)-1-[5-ethenyl-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]pyrrolidin-2-yl]-3-phenylpyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | C=Cc1cn(COCC[Si](C)(C)C)c2ncnc(N3CCC[C@H]3c3nn4cccc4c(=O)n3-c3ccccc3)c12 |
| InChI | InChI=1S/C30H35N7O2Si/c1-5-22-19-34(21-39-17-18-40(2,3)4)28-26(22)29(32-20-31-28)35-15-9-13-24(35)27-33-36-16-10-14-25(36)30(38)37(27)23-11-7-6-8-12-23/h5-8,10-12,14,16,19-20,24H,1,9,13,15,17-18,21H2,2-4H3/t24-/m0/s1 |
| InChIKey | USHZAJRVXFPWOK-DEOSSOPVSA-N |
| XLogP | 5.53 |
| TPSA | 82.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|