C14H28N4 — CID 123523846
N-(3-iminobutan-2-yl)-N'-[(Z)-4-iminopent-2-en-3-yl]-2,2-dimethylpropane-1,3-diamine (PubChem CID 123523846) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is N-(3-iminobutan-2-yl)-N'-[(Z)-4-iminopent-2-en-3-yl]-2,2-dimethylpropane-1,3-diamine.
| Compound Name | N-(3-iminobutan-2-yl)-N'-[(Z)-4-iminopent-2-en-3-yl]-2,2-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 123523846 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | N-(3-iminobutan-2-yl)-N'-[(Z)-4-iminopent-2-en-3-yl]-2,2-dimethylpropane-1,3-diamine |
| SMILES | [H]/N=C(C)/C(=C/C)NCC(C)(C)CNC(C)/C(C)=N/[H] |
| InChI | InChI=1S/C14H28N4/c1-7-13(11(3)16)18-9-14(5,6)8-17-12(4)10(2)15/h7,12,15-18H,8-9H2,1-6H3/b13-7-,15-10+,16-11+ |
| InChIKey | YKSOZMIDVWYYFN-TUZVOONZSA-N |
| XLogP | 2.56 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|