C24H30N7O7P — CID 123524399
methyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-cyano-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate (PubChem CID 123524399) has the molecular formula C24H30N7O7P and a molecular weight of 559.52 g/mol. Its IUPAC name is methyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-cyano-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate.
| Compound Name | methyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-cyano-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 123524399 |
| Molecular Formula | C24H30N7O7P |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | methyl 2-[[[5-(2-amino-6-methoxypurin-9-yl)-4-cyano-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]butanoate |
| SMILES | CCC(NP(=O)(OCC1CC(C)(C#N)C(n2cnc3c(OC)nc(N)nc32)O1)Oc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C24H30N7O7P/c1-5-17(21(32)35-4)30-39(33,38-15-9-7-6-8-10-15)36-12-16-11-24(2,13-25)22(37-16)31-14-27-18-19(31)28-23(26)29-20(18)34-3/h6-10,14,16-17,22H,5,11-12H2,1-4H3,(H,30,33)(H2,26,28,29) |
| InChIKey | CPHHXFIGVXJDAF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 185.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|