About 4-nitro-2,3-dihydro-1H-pyrazole
4-nitro-2,3-dihydro-1H-pyrazole (PubChem CID 123525066) has the molecular formula C3H5N3O2
and a molecular weight of 115.09 g/mol. Its IUPAC name is 4-nitro-2,3-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 4-nitro-2,3-dihydro-1H-pyrazole |
| PubChem CID | 123525066 |
| Molecular Formula | C3H5N3O2 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 4-nitro-2,3-dihydro-1H-pyrazole |
| SMILES | O=[N+]([O-])C1=CNNC1 |
| InChI | InChI=1S/C3H5N3O2/c7-6(8)3-1-4-5-2-3/h1,4-5H,2H2 |
| InChIKey | CIMOFQULOIRGNC-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-2,3-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-2,3-dihydro-1H-pyrazole?
The IUPAC name of 4-nitro-2,3-dihydro-1H-pyrazole (CID 123525066) is 4-nitro-2,3-dihydro-1H-pyrazole.
What is the SMILES notation for 4-nitro-2,3-dihydro-1H-pyrazole?
The canonical SMILES for 4-nitro-2,3-dihydro-1H-pyrazole is O=[N+]([O-])C1=CNNC1.
What is the InChIKey of 4-nitro-2,3-dihydro-1H-pyrazole?
The InChIKey is CIMOFQULOIRGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O2/c7-6(8)3-1-4-5-2-3/h1,4-5H,2H2.
What are the key properties of 4-nitro-2,3-dihydro-1H-pyrazole?
4-nitro-2,3-dihydro-1H-pyrazole has a molecular weight of 115.09 g/mol, XLogP of -0.79, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-2,3-dihydro-1H-pyrazole is sourced from PubChem (CID 123525066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).