About 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide
2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide (PubChem CID 123525091) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide.
Molecular Properties
| Compound Name | 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide |
| PubChem CID | 123525091 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide |
| SMILES | CN1CC2(CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C8H15NO2S/c1-9-6-8(7-9)2-4-12(10,11)5-3-8/h2-7H2,1H3 |
| InChIKey | RMWOHIYVEZWHRR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide?
The IUPAC name of 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide (CID 123525091) is 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide.
What is the SMILES notation for 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide?
The canonical SMILES for 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide is CN1CC2(CCS(=O)(=O)CC2)C1.
What is the InChIKey of 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide?
The InChIKey is RMWOHIYVEZWHRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-9-6-8(7-9)2-4-12(10,11)5-3-8/h2-7H2,1H3.
What are the key properties of 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide?
2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide has a molecular weight of 189.28 g/mol, XLogP of 0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7λ6-thia-2-azaspiro[3.5]nonane 7,7-dioxide is sourced from PubChem (CID 123525091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).