C22H36F2N2O2 — CID 123525255
2-fluoro-N-[2-(2-fluorooct-2-enoylamino)cyclopentyl]non-2-enamide (PubChem CID 123525255) has the molecular formula C22H36F2N2O2 and a molecular weight of 398.54 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-fluorooct-2-enoylamino)cyclopentyl]non-2-enamide.
| Compound Name | 2-fluoro-N-[2-(2-fluorooct-2-enoylamino)cyclopentyl]non-2-enamide |
|---|---|
| PubChem CID | 123525255 |
| Molecular Formula | C22H36F2N2O2 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2-fluoro-N-[2-(2-fluorooct-2-enoylamino)cyclopentyl]non-2-enamide |
| SMILES | CCCCCC=C(F)C(=O)NC1CCCC1NC(=O)C(F)=CCCCCCC |
| InChI | InChI=1S/C22H36F2N2O2/c1-3-5-7-9-11-14-18(24)22(28)26-20-16-12-15-19(20)25-21(27)17(23)13-10-8-6-4-2/h13-14,19-20H,3-12,15-16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | LHRBWXSTYYXTPW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|