C29H37F4NO — CID 123525542
3-(2-ethyl-1-fluoroheptylidene)-2,4,7,7-tetramethyl-4-[3-(trifluoromethyl)phenyl]-6,8-dihydroquinolin-5-one (PubChem CID 123525542) has the molecular formula C29H37F4NO and a molecular weight of 491.61 g/mol. Its IUPAC name is 3-(2-ethyl-1-fluoroheptylidene)-2,4,7,7-tetramethyl-4-[3-(trifluoromethyl)phenyl]-6,8-dihydroquinolin-5-one.
| Compound Name | 3-(2-ethyl-1-fluoroheptylidene)-2,4,7,7-tetramethyl-4-[3-(trifluoromethyl)phenyl]-6,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 123525542 |
| Molecular Formula | C29H37F4NO |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 3-(2-ethyl-1-fluoroheptylidene)-2,4,7,7-tetramethyl-4-[3-(trifluoromethyl)phenyl]-6,8-dihydroquinolin-5-one |
| SMILES | CCCCCC(CC)C(F)=C1C(C)=NC2=C(C(=O)CC(C)(C)C2)C1(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H37F4NO/c1-7-9-10-12-19(8-2)26(30)24-18(3)34-22-16-27(4,5)17-23(35)25(22)28(24,6)20-13-11-14-21(15-20)29(31,32)33/h11,13-15,19H,7-10,12,16-17H2,1-6H3 |
| InChIKey | ZTGVEYSSNWODDE-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|