About 1-chloro-6,7-dihydroisoquinoline
1-chloro-6,7-dihydroisoquinoline (PubChem CID 123525909) has the molecular formula C9H8ClN
and a molecular weight of 165.62 g/mol. Its IUPAC name is 1-chloro-6,7-dihydroisoquinoline.
Molecular Properties
| Compound Name | 1-chloro-6,7-dihydroisoquinoline |
| PubChem CID | 123525909 |
| Molecular Formula | C9H8ClN |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 1-chloro-6,7-dihydroisoquinoline |
| SMILES | Clc1nccc2c1=CCCC=2 |
| InChI | InChI=1S/C9H8ClN/c10-9-8-4-2-1-3-7(8)5-6-11-9/h3-6H,1-2H2 |
| InChIKey | LKKGENWQJBFDDD-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-6,7-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-6,7-dihydroisoquinoline?
The IUPAC name of 1-chloro-6,7-dihydroisoquinoline (CID 123525909) is 1-chloro-6,7-dihydroisoquinoline.
What is the SMILES notation for 1-chloro-6,7-dihydroisoquinoline?
The canonical SMILES for 1-chloro-6,7-dihydroisoquinoline is Clc1nccc2c1=CCCC=2.
What is the InChIKey of 1-chloro-6,7-dihydroisoquinoline?
The InChIKey is LKKGENWQJBFDDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN/c10-9-8-4-2-1-3-7(8)5-6-11-9/h3-6H,1-2H2.
What are the key properties of 1-chloro-6,7-dihydroisoquinoline?
1-chloro-6,7-dihydroisoquinoline has a molecular weight of 165.62 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-6,7-dihydroisoquinoline is sourced from PubChem (CID 123525909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).