About 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene
1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene (PubChem CID 123526048) has the molecular formula C8H3Cl2F3
and a molecular weight of 227.01 g/mol. Its IUPAC name is 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene.
Molecular Properties
| Compound Name | 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene |
| PubChem CID | 123526048 |
| Molecular Formula | C8H3Cl2F3 |
| Molecular Weight | 227.01 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene |
| SMILES | Fc1cc(F)c(C(Cl)=CCl)cc1F |
| InChI | InChI=1S/C8H3Cl2F3/c9-3-5(10)4-1-7(12)8(13)2-6(4)11/h1-3H |
| InChIKey | BGOXRNOXHMFIKG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.01 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene?
The IUPAC name of 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene (CID 123526048) is 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene.
What is the SMILES notation for 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene?
The canonical SMILES for 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene is Fc1cc(F)c(C(Cl)=CCl)cc1F.
What is the InChIKey of 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene?
The InChIKey is BGOXRNOXHMFIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl2F3/c9-3-5(10)4-1-7(12)8(13)2-6(4)11/h1-3H.
What are the key properties of 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene?
1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene has a molecular weight of 227.01 g/mol, XLogP of 3.88, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dichloroethenyl)-2,4,5-trifluorobenzene is sourced from PubChem (CID 123526048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).