C23H21F6NO2 — CID 123526757
5-[2-methyl-5-(trifluoromethyl)phenyl]-1-[3-methyl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 123526757) has the molecular formula C23H21F6NO2 and a molecular weight of 457.41 g/mol. Its IUPAC name is 5-[2-methyl-5-(trifluoromethyl)phenyl]-1-[3-methyl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | 5-[2-methyl-5-(trifluoromethyl)phenyl]-1-[3-methyl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 123526757 |
| Molecular Formula | C23H21F6NO2 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 5-[2-methyl-5-(trifluoromethyl)phenyl]-1-[3-methyl-5-(trifluoromethyl)phenyl]-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | Cc1cc(C2OC(=O)N3C(c4cc(C(F)(F)F)ccc4C)CCCC23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H21F6NO2/c1-12-8-14(10-16(9-12)23(27,28)29)20-19-5-3-4-18(30(19)21(31)32-20)17-11-15(22(24,25)26)7-6-13(17)2/h6-11,18-20H,3-5H2,1-2H3 |
| InChIKey | NSSZREUAFFXBSD-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |