C20H19Cl2F3N3S+ — CID 123527281
aminomethylidene-[N-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-C-methylsulfanylcarbonimidoyl]-methylazanium (PubChem CID 123527281) has the molecular formula C20H19Cl2F3N3S+ and a molecular weight of 461.36 g/mol. Its IUPAC name is aminomethylidene-[N-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-C-methylsulfanylcarbonimidoyl]-methylazanium.
| Compound Name | aminomethylidene-[N-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-C-methylsulfanylcarbonimidoyl]-methylazanium |
|---|---|
| PubChem CID | 123527281 |
| Molecular Formula | C20H19Cl2F3N3S+ |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | aminomethylidene-[N-[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]-C-methylsulfanylcarbonimidoyl]-methylazanium |
| SMILES | CS/C(=N\c1ccc(C=CC(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1)[N+](C)=CN |
| InChI | InChI=1S/C20H18Cl2F3N3S/c1-28(12-26)19(29-2)27-17-6-3-13(4-7-17)5-8-18(20(23,24)25)14-9-15(21)11-16(22)10-14/h3-12,18,26H,1-2H3/p+1/b8-5?,27-19- |
| InChIKey | SAFWAXVSBZRSLT-ABDNSDKRSA-O |
| XLogP | 6.33 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|