About [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate
[(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate (PubChem CID 123527331) has the molecular formula C20H26ClN3O4
and a molecular weight of 407.90 g/mol. Its IUPAC name is [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate |
| PubChem CID | 123527331 |
| Molecular Formula | C20H26ClN3O4 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H]1COCC[C@H]1COc1ccc(-n2cc(Cl)cn2)cc1 |
| InChI | InChI=1S/C20H26ClN3O4/c1-20(2,3)23-19(25)28-18-13-26-9-8-14(18)12-27-17-6-4-16(5-7-17)24-11-15(21)10-22-24/h4-7,10-11,14,18H,8-9,12-13H2,1-3H3,(H,23,25)/t14-,18-/m0/s1 |
| InChIKey | VARXPBCZWRFPIS-KSSFIOAISA-N |
| XLogP | 3.83 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate?
The IUPAC name of [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate (CID 123527331) is [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate.
What is the SMILES notation for [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate?
The canonical SMILES for [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate is CC(C)(C)NC(=O)O[C@H]1COCC[C@H]1COc1ccc(-n2cc(Cl)cn2)cc1.
What is the InChIKey of [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate?
The InChIKey is VARXPBCZWRFPIS-KSSFIOAISA-N. The full InChI is InChI=1S/C20H26ClN3O4/c1-20(2,3)23-19(25)28-18-13-26-9-8-14(18)12-27-17-6-4-16(5-7-17)24-11-15(21)10-22-24/h4-7,10-11,14,18H,8-9,12-13H2,1-3H3,(H,23,25)/t14-,18-/m0/s1.
What are the key properties of [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate?
[(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate has a molecular weight of 407.90 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-[[4-(4-chloropyrazol-1-yl)phenoxy]methyl]oxan-3-yl] N-tert-butylcarbamate is sourced from PubChem (CID 123527331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).