C21H31NO3 — CID 123527337
N-[5,5-dimethyl-1-(2-methyloxiran-2-yl)-1-oxohexan-2-yl]-2-methyl-3-phenylpropanamide (PubChem CID 123527337) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is N-[5,5-dimethyl-1-(2-methyloxiran-2-yl)-1-oxohexan-2-yl]-2-methyl-3-phenylpropanamide.
| Compound Name | N-[5,5-dimethyl-1-(2-methyloxiran-2-yl)-1-oxohexan-2-yl]-2-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 123527337 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | N-[5,5-dimethyl-1-(2-methyloxiran-2-yl)-1-oxohexan-2-yl]-2-methyl-3-phenylpropanamide |
| SMILES | CC(Cc1ccccc1)C(=O)NC(CCC(C)(C)C)C(=O)C1(C)CO1 |
| InChI | InChI=1S/C21H31NO3/c1-15(13-16-9-7-6-8-10-16)19(24)22-17(11-12-20(2,3)4)18(23)21(5)14-25-21/h6-10,15,17H,11-14H2,1-5H3,(H,22,24) |
| InChIKey | GCBKIFMECCAKKG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|