C40H40BrN7O2 — CID 123527606
tert-butyl N-[4-[[3-(6-bromo-2-pyridinyl)-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-tritylamino]cyclohexyl]carbamate (PubChem CID 123527606) has the molecular formula C40H40BrN7O2 and a molecular weight of 730.71 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-(6-bromo-2-pyridinyl)-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-tritylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-(6-bromo-2-pyridinyl)-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-tritylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 123527606 |
| Molecular Formula | C40H40BrN7O2 |
| Molecular Weight | 730.71 g/mol |
| Exact Mass | 729.24 |
| IUPAC Name | tert-butyl N-[4-[[3-(6-bromo-2-pyridinyl)-2H-pyrazolo[3,4-d]pyrimidin-6-yl]-tritylamino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N(c2ncc3c(-c4cccc(Br)n4)[nH]nc3n2)C(c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C40H40BrN7O2/c1-39(2,3)50-38(49)43-30-22-24-31(25-23-30)48(37-42-26-32-35(46-47-36(32)45-37)33-20-13-21-34(41)44-33)40(27-14-7-4-8-15-27,28-16-9-5-10-17-28)29-18-11-6-12-19-29/h4-21,26,30-31H,22-25H2,1-3H3,(H,43,49)(H,42,45,46,47) |
| InChIKey | AUXIDZVSLINZRU-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.71 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|