C29H54FN7O+2 — CID 123527616
3,3-diamino-2-(4-ethyl-6-fluoro-1,8-dimethyl-4-azoniabicyclo[6.1.0]non-3-en-3-yl)-N-(4-imidazolidin-1-yl-1,6-dipropyl-2,3,4,5-tetrahydropyridin-1-ium-5-yl)propanamide (PubChem CID 123527616) has the molecular formula C29H54FN7O+2 and a molecular weight of 535.80 g/mol. Its IUPAC name is 3,3-diamino-2-(4-ethyl-6-fluoro-1,8-dimethyl-4-azoniabicyclo[6.1.0]non-3-en-3-yl)-N-(4-imidazolidin-1-yl-1,6-dipropyl-2,3,4,5-tetrahydropyridin-1-ium-5-yl)propanamide.
| Compound Name | 3,3-diamino-2-(4-ethyl-6-fluoro-1,8-dimethyl-4-azoniabicyclo[6.1.0]non-3-en-3-yl)-N-(4-imidazolidin-1-yl-1,6-dipropyl-2,3,4,5-tetrahydropyridin-1-ium-5-yl)propanamide |
|---|---|
| PubChem CID | 123527616 |
| Molecular Formula | C29H54FN7O+2 |
| Molecular Weight | 535.80 g/mol |
| Exact Mass | 535.44 |
| IUPAC Name | 3,3-diamino-2-(4-ethyl-6-fluoro-1,8-dimethyl-4-azoniabicyclo[6.1.0]non-3-en-3-yl)-N-(4-imidazolidin-1-yl-1,6-dipropyl-2,3,4,5-tetrahydropyridin-1-ium-5-yl)propanamide |
| SMILES | CCCC1=[N+](CCC)CCC(N2CCNC2)C1NC(=O)C(/C1=[N+](\CC)CC(F)CC2(C)CC2(C)C1)C(N)N |
| InChI | InChI=1S/C29H53FN7O/c1-6-9-21-25(22(37-14-11-33-19-37)10-13-36(21)12-7-2)34-27(38)24(26(31)32)23-16-29(5)18-28(29,4)15-20(30)17-35(23)8-3/h20,22,24-26,33H,6-19,31-32H2,1-5H3/q+1/p+1/b35-23+ |
| InChIKey | BGNWMDVJJSYMOQ-QCFMCPCVSA-O |
| XLogP | 1.65 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.80 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|