C29H23BF2N2O3 — CID 123527670
3-[2-(2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione (PubChem CID 123527670) has the molecular formula C29H23BF2N2O3 and a molecular weight of 496.32 g/mol. Its IUPAC name is 3-[2-(2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione.
| Compound Name | 3-[2-(2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione |
|---|---|
| PubChem CID | 123527670 |
| Molecular Formula | C29H23BF2N2O3 |
| Molecular Weight | 496.32 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 3-[2-(2,2-difluoro-6,10,12-trimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)ethenyl]-10,11-didehydro-8,9-dihydro-6H-cycloocta[g]chromene-2,7-dione |
| SMILES | CC1=CC(C=Cc2cc3cc4c(cc3oc2=O)C#CCCC(=O)C4)=[N+]2C1=Cc1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C29H23BF2N2O3/c1-17-10-19(3)33-26(17)16-27-18(2)11-24(34(27)30(33,31)32)9-8-21-12-23-13-22-14-25(35)7-5-4-6-20(22)15-28(23)37-29(21)36/h8-13,15-16H,5,7,14H2,1-3H3 |
| InChIKey | IJHWRDDKQHLNML-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 55.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|