C26H25ClFN5O2S — CID 123527678
3-(4-chloro-2-fluorophenyl)-1-[3-[2-[2-[ethyl(methyl)amino]ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-1-hydroxyurea (PubChem CID 123527678) has the molecular formula C26H25ClFN5O2S and a molecular weight of 526.04 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorophenyl)-1-[3-[2-[2-[ethyl(methyl)amino]ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-1-hydroxyurea.
| Compound Name | 3-(4-chloro-2-fluorophenyl)-1-[3-[2-[2-[ethyl(methyl)amino]ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 123527678 |
| Molecular Formula | C26H25ClFN5O2S |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 3-(4-chloro-2-fluorophenyl)-1-[3-[2-[2-[ethyl(methyl)amino]ethyl]-4-pyridin-4-yl-1,3-thiazol-5-yl]phenyl]-1-hydroxyurea |
| SMILES | CCN(C)CCc1nc(-c2ccncc2)c(-c2cccc(N(O)C(=O)Nc3ccc(Cl)cc3F)c2)s1 |
| InChI | InChI=1S/C26H25ClFN5O2S/c1-3-32(2)14-11-23-31-24(17-9-12-29-13-10-17)25(36-23)18-5-4-6-20(15-18)33(35)26(34)30-22-8-7-19(27)16-21(22)28/h4-10,12-13,15-16,35H,3,11,14H2,1-2H3,(H,30,34) |
| InChIKey | IWVZAVPAKVJOLS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|