C25H27ClN6O2 — CID 123527830
3-[4-(2-chlorohepta-2,4-dien-3-ylcarbamoylamino)pyrazol-1-yl]-N-(2,6-dimethyl-3-pyridinyl)benzamide (PubChem CID 123527830) has the molecular formula C25H27ClN6O2 and a molecular weight of 478.98 g/mol. Its IUPAC name is 3-[4-(2-chlorohepta-2,4-dien-3-ylcarbamoylamino)pyrazol-1-yl]-N-(2,6-dimethyl-3-pyridinyl)benzamide.
| Compound Name | 3-[4-(2-chlorohepta-2,4-dien-3-ylcarbamoylamino)pyrazol-1-yl]-N-(2,6-dimethyl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 123527830 |
| Molecular Formula | C25H27ClN6O2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 3-[4-(2-chlorohepta-2,4-dien-3-ylcarbamoylamino)pyrazol-1-yl]-N-(2,6-dimethyl-3-pyridinyl)benzamide |
| SMILES | CCC=CC(NC(=O)Nc1cnn(-c2cccc(C(=O)Nc3ccc(C)nc3C)c2)c1)=C(C)Cl |
| InChI | InChI=1S/C25H27ClN6O2/c1-5-6-10-22(17(3)26)31-25(34)29-20-14-27-32(15-20)21-9-7-8-19(13-21)24(33)30-23-12-11-16(2)28-18(23)4/h6-15H,5H2,1-4H3,(H,30,33)(H2,29,31,34) |
| InChIKey | VUFWHWYCBOMYLO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|