C17H29N4+ — CID 123528129
1,10-dimethyl-1-propyl-2,3,4,7,8,9-hexahydro-1,10-phenanthrolin-1-ium-4,7-diamine (PubChem CID 123528129) has the molecular formula C17H29N4+ and a molecular weight of 289.45 g/mol. Its IUPAC name is 1,10-dimethyl-1-propyl-2,3,4,7,8,9-hexahydro-1,10-phenanthrolin-1-ium-4,7-diamine.
| Compound Name | 1,10-dimethyl-1-propyl-2,3,4,7,8,9-hexahydro-1,10-phenanthrolin-1-ium-4,7-diamine |
|---|---|
| PubChem CID | 123528129 |
| Molecular Formula | C17H29N4+ |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1,10-dimethyl-1-propyl-2,3,4,7,8,9-hexahydro-1,10-phenanthrolin-1-ium-4,7-diamine |
| SMILES | CCC[N+]1(C)CCC(N)c2ccc3c(c21)N(C)CCC3N |
| InChI | InChI=1S/C17H29N4/c1-4-10-21(3)11-8-15(19)13-6-5-12-14(18)7-9-20(2)16(12)17(13)21/h5-6,14-15H,4,7-11,18-19H2,1-3H3/q+1 |
| InChIKey | YYQLZXWXURLHSN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|