C11H16FNO — CID 123529240
N-(2-fluorohexa-1,3,5-trien-3-yl)-2,2-dimethylpropanamide (PubChem CID 123529240) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is N-(2-fluorohexa-1,3,5-trien-3-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(2-fluorohexa-1,3,5-trien-3-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123529240 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N-(2-fluorohexa-1,3,5-trien-3-yl)-2,2-dimethylpropanamide |
| SMILES | C=CC=C(NC(=O)C(C)(C)C)C(=C)F |
| InChI | InChI=1S/C11H16FNO/c1-6-7-9(8(2)12)13-10(14)11(3,4)5/h6-7H,1-2H2,3-5H3,(H,13,14) |
| InChIKey | UXQRZUYZZPAJDX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|