C44H87N5O5 — CID 123529398
2-N-(3-aminopropyl)-5-N-(2-hydroxypropyl)-2,2,3,4,4,5,5,6,7,7,8,8,9,10,10-pentadecamethyl-8-N-[3-(3-methylpentanoylamino)propyl]undecane-2,5,8-tricarboxamide (PubChem CID 123529398) has the molecular formula C44H87N5O5 and a molecular weight of 766.21 g/mol. Its IUPAC name is 2-N-(3-aminopropyl)-5-N-(2-hydroxypropyl)-2,2,3,4,4,5,5,6,7,7,8,8,9,10,10-pentadecamethyl-8-N-[3-(3-methylpentanoylamino)propyl]undecane-2,5,8-tricarboxamide.
| Compound Name | 2-N-(3-aminopropyl)-5-N-(2-hydroxypropyl)-2,2,3,4,4,5,5,6,7,7,8,8,9,10,10-pentadecamethyl-8-N-[3-(3-methylpentanoylamino)propyl]undecane-2,5,8-tricarboxamide |
|---|---|
| PubChem CID | 123529398 |
| Molecular Formula | C44H87N5O5 |
| Molecular Weight | 766.21 g/mol |
| Exact Mass | 765.67 |
| IUPAC Name | 2-N-(3-aminopropyl)-5-N-(2-hydroxypropyl)-2,2,3,4,4,5,5,6,7,7,8,8,9,10,10-pentadecamethyl-8-N-[3-(3-methylpentanoylamino)propyl]undecane-2,5,8-tricarboxamide |
| SMILES | CCC(C)CC(=O)NCCCNC(=O)C(C)(C(C)(C)C)C(C)(C)C(C)(C)C(C)(C(=O)NCC(C)O)C(C)(C)C(C)(C)C(C)(C(=O)NCCCN)C(C)(C)C |
| InChI | InChI=1S/C44H87N5O5/c1-21-30(2)28-32(51)46-26-23-27-48-34(53)43(19,37(7,8)9)39(12,13)41(16,17)44(20,35(54)49-29-31(3)50)40(14,15)38(10,11)42(18,36(4,5)6)33(52)47-25-22-24-45/h30-31,50H,21-29,45H2,1-20H3,(H,46,51)(H,47,52)(H,48,53)(H,49,54) |
| InChIKey | AXOKITCRKNETPX-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 162.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.21 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|