C37H41F3N2O8S — CID 123530044
2-O-[2-[2-(dimethylamino)-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl] 1-O-ethyl oxalate (PubChem CID 123530044) has the molecular formula C37H41F3N2O8S and a molecular weight of 730.80 g/mol. Its IUPAC name is 2-O-[2-[2-(dimethylamino)-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl] 1-O-ethyl oxalate.
| Compound Name | 2-O-[2-[2-(dimethylamino)-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl] 1-O-ethyl oxalate |
|---|---|
| PubChem CID | 123530044 |
| Molecular Formula | C37H41F3N2O8S |
| Molecular Weight | 730.80 g/mol |
| Exact Mass | 730.25 |
| IUPAC Name | 2-O-[2-[2-(dimethylamino)-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl] 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)OC(CCc1ccc(OC)cc1)(C1OC2SC(N(C)C)=NC2C(OCc2ccccc2)C1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C37H41F3N2O8S/c1-5-46-32(43)33(44)50-36(37(38,39)40,21-20-24-16-18-27(45-4)19-17-24)31-30(48-23-26-14-10-7-11-15-26)29(47-22-25-12-8-6-9-13-25)28-34(49-31)51-35(41-28)42(2)3/h6-19,28-31,34H,5,20-23H2,1-4H3 |
| InChIKey | RQNJPLNWZUNFGZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 105.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.80 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|