About [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate
[10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate (PubChem CID 123530734) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate |
| PubChem CID | 123530734 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate |
| SMILES | CCOC(O)c1c2ccc(OC(=O)N(C)C)cc2n2ccccc12 |
| InChI | InChI=1S/C18H20N2O4/c1-4-23-17(21)16-13-9-8-12(24-18(22)19(2)3)11-15(13)20-10-6-5-7-14(16)20/h5-11,17,21H,4H2,1-3H3 |
| InChIKey | TYOFEMJMFFPURX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate?
The IUPAC name of [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate (CID 123530734) is [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate.
What is the SMILES notation for [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate?
The canonical SMILES for [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate is CCOC(O)c1c2ccc(OC(=O)N(C)C)cc2n2ccccc12.
What is the InChIKey of [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate?
The InChIKey is TYOFEMJMFFPURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4/c1-4-23-17(21)16-13-9-8-12(24-18(22)19(2)3)11-15(13)20-10-6-5-7-14(16)20/h5-11,17,21H,4H2,1-3H3.
What are the key properties of [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate?
[10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate has a molecular weight of 328.37 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [10-[ethoxy(hydroxy)methyl]pyrido[1,2-a]indol-3-yl] N,N-dimethylcarbamate is sourced from PubChem (CID 123530734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).