C42H45F3N4O3S — CID 123530938
5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]thiophene-2-carboxamide (PubChem CID 123530938) has the molecular formula C42H45F3N4O3S and a molecular weight of 742.91 g/mol. Its IUPAC name is 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 123530938 |
| Molecular Formula | C42H45F3N4O3S |
| Molecular Weight | 742.91 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | 5-tert-butyl-N-[3-[4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]thiophene-2-carboxamide |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CC(NC(=O)c4ccc(C(C)(C)C)s4)C(=O)Nc4ccc(C(F)(F)F)cc4)cc3)nc2)cc1 |
| InChI | InChI=1S/C42H45F3N4O3S/c1-5-6-7-8-9-24-52-34-20-14-29(15-21-34)31-26-46-38(47-27-31)30-12-10-28(11-13-30)25-35(49-40(51)36-22-23-37(53-36)41(2,3)4)39(50)48-33-18-16-32(17-19-33)42(43,44)45/h10-23,26-27,35H,5-9,24-25H2,1-4H3,(H,48,50)(H,49,51) |
| InChIKey | XMNXVMAKSALEIA-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.91 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|