C29H52O3 — CID 123531947
1-(2-cyclohexylpropan-2-yloxy)-2-[3-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol (PubChem CID 123531947) has the molecular formula C29H52O3 and a molecular weight of 448.73 g/mol. Its IUPAC name is 1-(2-cyclohexylpropan-2-yloxy)-2-[3-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol.
| Compound Name | 1-(2-cyclohexylpropan-2-yloxy)-2-[3-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 123531947 |
| Molecular Formula | C29H52O3 |
| Molecular Weight | 448.73 g/mol |
| Exact Mass | 448.39 |
| IUPAC Name | 1-(2-cyclohexylpropan-2-yloxy)-2-[3-(3,3,6,6-tetramethyloctan-4-yl)cyclohexa-1,5-dien-1-yl]oxyethanol |
| SMILES | CCC(C)(C)CC(C1C=C(OCC(O)OC(C)(C)C2CCCCC2)C=CC1)C(C)(C)CC |
| InChI | InChI=1S/C29H52O3/c1-9-27(3,4)20-25(28(5,6)10-2)22-15-14-18-24(19-22)31-21-26(30)32-29(7,8)23-16-12-11-13-17-23/h14,18-19,22-23,25-26,30H,9-13,15-17,20-21H2,1-8H3 |
| InChIKey | BZFBGMRZPSHHJS-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.73 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|