About 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine
3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (PubChem CID 123532002) has the molecular formula C11H16F3N
and a molecular weight of 219.25 g/mol. Its IUPAC name is 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 123532002 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine |
| SMILES | CCC1C=C(N(C)C)C=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3N/c1-4-8-5-9(11(12,13)14)7-10(6-8)15(2)3/h6-8H,4-5H2,1-3H3 |
| InChIKey | GLHABVAIDZSPBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine (CID 123532002) is 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is CCC1C=C(N(C)C)C=C(C(F)(F)F)C1.
What is the InChIKey of 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
The InChIKey is GLHABVAIDZSPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N/c1-4-8-5-9(11(12,13)14)7-10(6-8)15(2)3/h6-8H,4-5H2,1-3H3.
What are the key properties of 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine?
3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine has a molecular weight of 219.25 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,N-dimethyl-5-(trifluoromethyl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 123532002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).