C26H20N6O — CID 1235325
5-amino-3-ethyl-1-(6-naphthalen-1-yloxy-2-phenylpyrimidin-4-yl)pyrazole-4-carbonitrile (PubChem CID 1235325) has the molecular formula C26H20N6O and a molecular weight of 432.49 g/mol. Its IUPAC name is 5-amino-3-ethyl-1-(6-naphthalen-1-yloxy-2-phenylpyrimidin-4-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-ethyl-1-(6-naphthalen-1-yloxy-2-phenylpyrimidin-4-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 1235325 |
| Molecular Formula | C26H20N6O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 5-amino-3-ethyl-1-(6-naphthalen-1-yloxy-2-phenylpyrimidin-4-yl)pyrazole-4-carbonitrile |
| SMILES | CCc1nn(-c2cc(Oc3cccc4ccccc34)nc(-c3ccccc3)n2)c(N)c1C#N |
| InChI | InChI=1S/C26H20N6O/c1-2-21-20(16-27)25(28)32(31-21)23-15-24(30-26(29-23)18-10-4-3-5-11-18)33-22-14-8-12-17-9-6-7-13-19(17)22/h3-15H,2,28H2,1H3 |
| InChIKey | DVXKYIJIPVPGEV-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |