About 2-dimethylsilylethyl thiocyanate
2-dimethylsilylethyl thiocyanate (PubChem CID 123532574) has the molecular formula C5H11NSSi
and a molecular weight of 145.30 g/mol. Its IUPAC name is 2-dimethylsilylethyl thiocyanate.
Molecular Properties
| Compound Name | 2-dimethylsilylethyl thiocyanate |
| PubChem CID | 123532574 |
| Molecular Formula | C5H11NSSi |
| Molecular Weight | 145.30 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 2-dimethylsilylethyl thiocyanate |
| SMILES | C[SiH](C)CCSC#N |
| InChI | InChI=1S/C5H11NSSi/c1-8(2)4-3-7-5-6/h8H,3-4H2,1-2H3 |
| InChIKey | UTGBPRLXNJJFLW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsilylethyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsilylethyl thiocyanate?
The IUPAC name of 2-dimethylsilylethyl thiocyanate (CID 123532574) is 2-dimethylsilylethyl thiocyanate.
What is the SMILES notation for 2-dimethylsilylethyl thiocyanate?
The canonical SMILES for 2-dimethylsilylethyl thiocyanate is C[SiH](C)CCSC#N.
What is the InChIKey of 2-dimethylsilylethyl thiocyanate?
The InChIKey is UTGBPRLXNJJFLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NSSi/c1-8(2)4-3-7-5-6/h8H,3-4H2,1-2H3.
What are the key properties of 2-dimethylsilylethyl thiocyanate?
2-dimethylsilylethyl thiocyanate has a molecular weight of 145.30 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsilylethyl thiocyanate is sourced from PubChem (CID 123532574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).