C14H20BN3O2 — CID 123533032
N'-pyridin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine (PubChem CID 123533032) has the molecular formula C14H20BN3O2 and a molecular weight of 273.14 g/mol. Its IUPAC name is N'-pyridin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine.
| Compound Name | N'-pyridin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123533032 |
| Molecular Formula | C14H20BN3O2 |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N'-pyridin-4-yl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine |
| SMILES | [H]/N=C/C(/C=N/c1ccncc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H20BN3O2/c1-13(2)14(3,4)20-15(19-13)11(9-16)10-18-12-5-7-17-8-6-12/h5-11,16H,1-4H3/b16-9+,18-10+ |
| InChIKey | RRRGRGCTNQBLIW-FRCVOOFRSA-N |
| XLogP | 2.90 |
| TPSA | 67.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|