C22H26FNO2 — CID 123533304
5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-propylhepta-2,4,6-trienamide (PubChem CID 123533304) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-propylhepta-2,4,6-trienamide.
| Compound Name | 5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-propylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 123533304 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 5-[2-(3-fluorophenyl)ethynyl]-N-(1-hydroxy-2-methylpropan-2-yl)-2-propylhepta-2,4,6-trienamide |
| SMILES | C=CC(C#Cc1cccc(F)c1)=CC=C(CCC)C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C22H26FNO2/c1-5-8-19(21(26)24-22(3,4)16-25)14-13-17(6-2)11-12-18-9-7-10-20(23)15-18/h6-7,9-10,13-15,25H,2,5,8,16H2,1,3-4H3,(H,24,26) |
| InChIKey | QENOGRYYXURQOP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|