C23H32N2O5 — CID 123533445
N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-3-(5-hydroxy-3-oxohex-1-enyl)benzamide (PubChem CID 123533445) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-3-(5-hydroxy-3-oxohex-1-enyl)benzamide.
| Compound Name | N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-3-(5-hydroxy-3-oxohex-1-enyl)benzamide |
|---|---|
| PubChem CID | 123533445 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-[4-(5,5-dimethyl-1,3-dioxan-2-yl)butylideneamino]-3-(5-hydroxy-3-oxohex-1-enyl)benzamide |
| SMILES | CC(O)CC(=O)C=Cc1cccc(C(=O)NN=CCCCC2OCC(C)(C)CO2)c1 |
| InChI | InChI=1S/C23H32N2O5/c1-17(26)13-20(27)11-10-18-7-6-8-19(14-18)22(28)25-24-12-5-4-9-21-29-15-23(2,3)16-30-21/h6-8,10-12,14,17,21,26H,4-5,9,13,15-16H2,1-3H3,(H,25,28) |
| InChIKey | DNKUMUURVQBNQS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|