C32H44O5S — CID 123533638
1-[4-[5',17'-dihydroxy-5,5,13'-trimethyl-17'-(sulfanylmethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]ethanone (PubChem CID 123533638) has the molecular formula C32H44O5S and a molecular weight of 540.77 g/mol. Its IUPAC name is 1-[4-[5',17'-dihydroxy-5,5,13'-trimethyl-17'-(sulfanylmethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]ethanone.
| Compound Name | 1-[4-[5',17'-dihydroxy-5,5,13'-trimethyl-17'-(sulfanylmethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 123533638 |
| Molecular Formula | C32H44O5S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 1-[4-[5',17'-dihydroxy-5,5,13'-trimethyl-17'-(sulfanylmethyl)spiro[1,3-dioxane-2,3'-2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-11'-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(C2CC3(C)C(CCC3(O)CS)C3CCC4(O)CC5(CCC4=C23)OCC(C)(C)CO5)cc1 |
| InChI | InChI=1S/C32H44O5S/c1-20(33)21-5-7-22(8-6-21)24-15-29(4)25(10-13-31(29,35)19-38)23-9-12-30(34)16-32(14-11-26(30)27(23)24)36-17-28(2,3)18-37-32/h5-8,23-25,34-35,38H,9-19H2,1-4H3 |
| InChIKey | CNLYNEUFCPSPJC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|